EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO6 |
| Net Charge | 0 |
| Average Mass | 219.193 |
| Monoisotopic Mass | 219.07429 |
| SMILES | N[C@@H](CCOC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13NO6/c9-5(8(13)14)3-4-15-7(12)2-1-6(10)11/h5H,1-4,9H2,(H,10,11)(H,13,14)/t5-/m0/s1 |
| InChIKey | GNISQJGXJIDKDJ-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (22855027) | ||
| - | PubMed (21988831) | ||
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (14607989) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-succinyl-L-homoserine (CHEBI:16160) has role Escherichia coli metabolite (CHEBI:76971) |
| O-succinyl-L-homoserine (CHEBI:16160) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| O-succinyl-L-homoserine (CHEBI:16160) is a hemisuccinate (CHEBI:138979) |
| O-succinyl-L-homoserine (CHEBI:16160) is a o-succinylhomoserine (CHEBI:181442) |
| O-succinyl-L-homoserine (CHEBI:16160) is conjugate acid of O-succinyl-L-homoserinate(1−) (CHEBI:57661) |
| Incoming Relation(s) |
| O-succinyl-L-homoserinate(1−) (CHEBI:57661) is conjugate base of O-succinyl-L-homoserine (CHEBI:16160) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(3-carboxypropanoyloxy)butanoic acid |
| Synonyms | Source |
|---|---|
| O4-Succinyl-L-homoserine | KEGG COMPOUND |
| O-Succinylhomoserine | KEGG COMPOUND |
| O-succinyl-L-homoserine | ChEBI |
| O-Succinyl-L-homoserine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00019621 | KNApSAcK |
| C01118 | KEGG COMPOUND |
| C01118 | KEGG COMPOUND |
| O-SUCCINYL-L-HOMOSERINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1973467 | Reaxys |
| CAS:1492-23-5 | KEGG COMPOUND |
| CAS:1492-23-5 | ChemIDplus |
| Citations |
|---|