EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15961 - O-phospho-L-homoserine
| Formula | C4H10NO6P |
| Net Charge | 0 |
| Average Mass | 199.099 |
| Monoisotopic Mass | 199.02457 |
| SMILES | N[C@@H](CCOP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C4H10NO6P/c5-3(4(6)7)1-2-11-12(8,9)10/h3H,1-2,5H2,(H,6,7)(H2,8,9,10)/t3-/m0/s1 |
| InChIKey | FXDNYOANAXWZHG-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-phospho-L-homoserine (CHEBI:15961) has role Escherichia coli metabolite (CHEBI:76971) |
| O-phospho-L-homoserine (CHEBI:15961) is a O-phosphorylhomoserine (CHEBI:21969) |
| O-phospho-L-homoserine (CHEBI:15961) is conjugate acid of O-phosphonato-L-homoserine(2−) (CHEBI:57590) |
| Incoming Relation(s) |
| O-phosphonato-L-homoserine(2−) (CHEBI:57590) is conjugate base of O-phospho-L-homoserine (CHEBI:15961) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(phosphonooxy)butanoic acid |
| Synonyms | Source |
|---|---|
| O-Phospho-L-homoserine | KEGG COMPOUND |
| O-phospho-L-homoserine | ChEBI |
| O-Phosphohomoserine | ChemIDplus |
| Homoserine phosphate | ChemIDplus |
| L-Homoserine, dihydrogen phosphate (ester) | ChemIDplus |