EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H23ClN4O4 |
| Net Charge | 0 |
| Average Mass | 478.936 |
| Monoisotopic Mass | 478.14078 |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1Cl)c1cnc2ncnc(N[C@@H]3CC[C@@H](CO)OC3)c12 |
| InChI | InChI=1S/C25H23ClN4O4/c26-21-10-17(34-16-4-2-1-3-5-16)8-9-19(21)23(32)20-11-27-24-22(20)25(29-14-28-24)30-15-6-7-18(12-31)33-13-15/h1-5,8-11,14-15,18,31H,6-7,12-13H2,(H2,27,28,29,30)/t15-,18+/m1/s1 |
| InChIKey | JSFCZQSJQXFJDS-QAPCUYQASA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nemtabrutinib (CHEBI:758429) has role antineoplastic agent (CHEBI:35610) |
| nemtabrutinib (CHEBI:758429) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| ARQ-531 | ChEMBL |
| MK-1026 | ChEMBL |
| Nemtabrutinib | ChEMBL |
| Citations |
|---|