EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32N6O4 |
| Net Charge | 0 |
| Average Mass | 444.536 |
| Monoisotopic Mass | 444.24850 |
| SMILES | COC(=O)NCCCn1nc([C@@H](C)N(C(=O)[C@H]2CNCCO2)C2CC2)c2ccc(C)nc21 |
| InChI | InChI=1S/C22H32N6O4/c1-14-5-8-17-19(26-27(20(17)25-14)11-4-9-24-22(30)31-3)15(2)28(16-6-7-16)21(29)18-13-23-10-12-32-18/h5,8,15-16,18,23H,4,6-7,9-13H2,1-3H3,(H,24,30)/t15-,18-/m1/s1 |
| InChIKey | GRTDDIZIUSADLD-CRAIPNDOSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anti-inflammatory agent Any compound that has anti-inflammatory effects. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sitokiren (CHEBI:756605) has functional parent β-amino acid (CHEBI:33706) |
| sitokiren (CHEBI:756605) has role anti-inflammatory agent (CHEBI:67079) |
| sitokiren (CHEBI:756605) has role antihypertensive agent (CHEBI:35674) |
| sitokiren (CHEBI:756605) has role hypoglycemic agent (CHEBI:35526) |
| sitokiren (CHEBI:756605) is a organonitrogen compound (CHEBI:35352) |
| sitokiren (CHEBI:756605) is a organooxygen compound (CHEBI:36963) |
| INNs | Source |
|---|---|
| sitokiren | WHO MedNet |
| sitokirene | WHO MedNet |
| sitokireno | WHO MedNet |
| Synonyms | Source |
|---|---|
| SPH-3127 | ChEMBL |
| SPH3127 | ChEMBL |
| Citations |
|---|