EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O2 |
| Net Charge | 0 |
| Average Mass | 148.161 |
| Monoisotopic Mass | 148.05243 |
| SMILES | [H]C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O2/c10-7-1-2-8-3-5-9(11)6-4-8/h1-7,11H/b2-1+ |
| InChIKey | CJXMVKYNVIGQBS-OWOJBTEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia galanga (ncbitaxon:94327) | rhizome (BTO:0001181) | PubMed (15930771) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) has functional parent (E)-cinnamaldehyde (CHEBI:16731) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) has role apoptosis inducer (CHEBI:68495) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) has role plant metabolite (CHEBI:76924) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) is a cinnamaldehydes (CHEBI:23245) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxyphenyl)prop-2-enal |
| Synonyms | Source |
|---|---|
| (2E)-3-(4-hydroxyphenyl)acrylaldehyde | IUPAC |
| 4-Hydroxycinnamyl aldehyde | KEGG COMPOUND |
| p-hydroxycinnamaldehyde | ChEBI |
| trans-4-hydroxycinnamaldehyde | ChEBI |
| p-Coumaraldehyde | KEGG COMPOUND |
| trans-p-Hydroxycinnamaldehyde | HMDB |
| UniProt Name | Source |
|---|---|
| (E)-4-coumaraldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05608 | KEGG COMPOUND |
| COUMARALDEHYDE | MetaCyc |
| HMDB0040986 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2242678 | Reaxys |
| CAS:2538-87-6 | KEGG COMPOUND |
| Citations |
|---|