EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23FN4O2 |
| Net Charge | 0 |
| Average Mass | 358.417 |
| Monoisotopic Mass | 358.18050 |
| SMILES | Cc1ccc(COC(=O)N2CC[C@H](CNc3ncccn3)[C@H](F)C2)cc1 |
| InChI | InChI=1S/C19H23FN4O2/c1-14-3-5-15(6-4-14)13-26-19(25)24-10-7-16(17(20)12-24)11-23-18-21-8-2-9-22-18/h2-6,8-9,16-17H,7,10-13H2,1H3,(H,21,22,23)/t16-,17-/m1/s1 |
| InChIKey | RECBFDWSXWAXHY-IAGOWNOFSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rislenemdaz (CHEBI:750420) has functional parent benzyl alcohol (CHEBI:17987) |
| rislenemdaz (CHEBI:750420) has role antidepressant (CHEBI:35469) |
| rislenemdaz (CHEBI:750420) is a carboxylic ester (CHEBI:33308) |
| INN | Source |
|---|---|
| rislenemdaz | WHO MedNet |
| Synonyms | Source |
|---|---|
| CERC-301 | ChEMBL |
| MK-0657 | ChEMBL |
| MK-0657, (-)- | ChEMBL |
| Rislenemdaz, (-)- | ChEMBL |