EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44O3 |
| Net Charge | 0 |
| Average Mass | 356.591 |
| Monoisotopic Mass | 356.32905 |
| SMILES | CCCCCCCCCC(O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H44O3/c1-2-3-4-5-9-12-15-18-21(23)19-16-13-10-7-6-8-11-14-17-20-22(24)25/h21,23H,2-20H2,1H3,(H,24,25) |
| InChIKey | BYCZEMFWXYCUSJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-hydroxydocosanoic acid (CHEBI:17314) has functional parent docosanoic acid (CHEBI:28941) |
| 13-hydroxydocosanoic acid (CHEBI:17314) is a hydroxy fatty acid (CHEBI:24654) |
| 13-hydroxydocosanoic acid (CHEBI:17314) is a long-chain fatty acid (CHEBI:15904) |
| 13-hydroxydocosanoic acid (CHEBI:17314) is conjugate acid of 13-hydroxydocosanoate (CHEBI:11320) |
| Incoming Relation(s) |
| 13-hydroxydocosanoate (CHEBI:11320) is conjugate base of 13-hydroxydocosanoic acid (CHEBI:17314) |
| IUPAC Name |
|---|
| 13-hydroxydocosanoic acid |
| Synonyms | Source |
|---|---|
| 13-Hydroxydocosanoate | KEGG COMPOUND |
| 13-Hydroxydocosanoic acid | KEGG COMPOUND |
| HDA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03049 | KEGG COMPOUND |
| C03049 | KEGG COMPOUND |
| LMFA01050210 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1795554 | Reaxys |
| CAS:13980-16-0 | ChemIDplus |
| Citations |
|---|