EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O10 |
| Net Charge | 0 |
| Average Mass | 434.397 |
| Monoisotopic Mass | 434.12130 |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c21 |
| InChI | InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-6,14,16,18-24,26-28H,7-8H2/t14-,16+,18+,19-,20+,21+/m0/s1 |
| InChIKey | DLIKSSGEMUFQOK-SFTVRKLSSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has functional parent (S)-naringenin (CHEBI:17846) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has role antibacterial agent (CHEBI:33282) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has role antilipemic drug (CHEBI:35679) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has role hypoglycemic agent (CHEBI:35526) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has role metabolite (CHEBI:25212) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a (2S)-flavan-4-one (CHEBI:140377) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a 4'-hydroxyflavanones (CHEBI:140331) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a dihydroxyflavanone (CHEBI:38749) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a flavanone 7-O-β-D-glucoside (CHEBI:13637) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (S)-7-(β-D-glucopyranosyloxy)-2,3-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| Naringenin 7-O-beta-D-glucoside | KEGG COMPOUND |
| Prunin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2S)-naringenin 7-O-β-D-glucoside | UniProt |
| Citations |
|---|