EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11FN2O5 |
| Net Charge | 0 |
| Average Mass | 246.194 |
| Monoisotopic Mass | 246.06520 |
| SMILES | C[C@H]1O[C@@H](n2cc(F)c(=O)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H11FN2O5/c1-3-5(13)6(14)8(17-3)12-2-4(10)7(15)11-9(12)16/h2-3,5-6,8,13-14H,1H3,(H,11,15,16)/t3-,5-,6-,8-/m1/s1 |
| InChIKey | ZWAOHEXOSAUJHY-ZIYNGMLESA-N |
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxifluridine (CHEBI:31521) has role antimetabolite (CHEBI:35221) |
| doxifluridine (CHEBI:31521) has role antineoplastic agent (CHEBI:35610) |
| doxifluridine (CHEBI:31521) has role prodrug (CHEBI:50266) |
| doxifluridine (CHEBI:31521) is a organofluorine compound (CHEBI:37143) |
| doxifluridine (CHEBI:31521) is a pyrimidine 5'-deoxyribonucleoside (CHEBI:74494) |
| IUPAC Name |
|---|
| 5'-deoxy-5-fluorouridine |
| INNs | Source |
|---|---|
| doxifluridina | ChemIDplus |
| doxifluridine | WHO MedNet |
| doxifluridine | ChemIDplus |
| doxifluridinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(β-D-5-desoxyribofuranoxyl)-5-fluoruracil | ChemIDplus |
| 5'-Dfur | ChemIDplus |
| 5'-DFUR | ChEBI |
| 5'-dFUrd | ChEBI |
| 5-fluoro-5'-deoxyuridine | ChEBI |
| Doxifluridine | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Furtulon | KEGG DRUG |
| Citations |
|---|