EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13N3O |
| Net Charge | 0 |
| Average Mass | 131.179 |
| Monoisotopic Mass | 131.10586 |
| SMILES | NCCCCNC(N)=O |
| InChI | InChI=1S/C5H13N3O/c6-3-1-2-4-8-5(7)9/h1-4,6H2,(H3,7,8,9) |
| InChIKey | YANFYYGANIYHGI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carbamoylputrescine (CHEBI:17902) is a N-substituted putrescine (CHEBI:26406) |
| N-carbamoylputrescine (CHEBI:17902) is conjugate base of N-carbamoylputrescinium(1+) (CHEBI:58318) |
| Incoming Relation(s) |
| N-carbamoylputrescinium(1+) (CHEBI:58318) is conjugate acid of N-carbamoylputrescine (CHEBI:17902) |
| IUPAC Name |
|---|
| 1-(4-aminobutyl)urea |
| Synonyms | Source |
|---|---|
| N-carbamoylputrescine | ChEBI |
| N-Carbamoylputrescine | KEGG COMPOUND |