EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24FeN3O15 |
| Net Charge | 0 |
| Average Mass | 722.373 |
| Monoisotopic Mass | 722.05568 |
| SMILES | [H][C@]12COC(=O)[C@]3([H])COC(=O)[C@]([H])(COC1=O)[NH2+]C(=O)c1cccc4c1[O][Fe-3]15([O]c6cccc(c6[O]1)C(=O)[NH2+]2)([O]c1cccc(c1[O]5)C(=O)[NH2+]3)[O]4 |
| InChI | InChI=1S/C30H27N3O15.Fe/c34-19-7-1-4-13(22(19)37)25(40)31-16-10-46-29(44)18(33-27(42)15-6-3-9-21(36)24(15)39)12-48-30(45)17(11-47-28(16)43)32-26(41)14-5-2-8-20(35)23(14)38;/h1-9,16-18,34-39H,10-12H2,(H,31,40)(H,32,41)(H,33,42);/q;+3/p-3/t16-,17-,18-;/m0./s1 |
| InChIKey | NGILTSZTOFYVBF-UVJOBNTFSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferrienterobactin (CHEBI:38151) is a Fe(III)-complexed siderophore (CHEBI:84734) |
| ferrienterobactin (CHEBI:38151) is conjugate acid of ferrienterobactin(3−) (CHEBI:28199) |
| Incoming Relation(s) |
| ferrienterobactin(3−) (CHEBI:28199) is conjugate base of ferrienterobactin (CHEBI:38151) |
| IUPAC Name |
|---|
| trihydrogen {N,N',N''-[(3S,7S,11S)-2,6,10-trioxo-1,5,9-trioxacyclododecane-3,7,11-triyl]tris[2,3-di(hydroxy-κO)benzamidato]}ferrate(3−) |
| Synonyms | Source |
|---|---|
| [Fe(H3ent)] | ChEBI |
| ferric enterochelin | ChemIDplus |
| ferrienterochelin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2492797 | Gmelin |
| Gmelin:2494966 | Gmelin |
| CAS:62280-34-6 | ChemIDplus |
| Citations |
|---|