EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23O14P |
| Net Charge | 0 |
| Average Mass | 422.276 |
| Monoisotopic Mass | 422.08254 |
| SMILES | O=P(O)(O)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23O14P/c13-1-3-10(7(16)8(17)11(19)24-3)26-12-9(18)6(15)5(14)4(25-12)2-23-27(20,21)22/h3-19H,1-2H2,(H2,20,21,22)/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
| InChIKey | ITPHOIFCAFNCLL-ASMJPISFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-maltose 6'-phosphate (CHEBI:15703) has functional parent maltose (CHEBI:17306) |
| α-maltose 6'-phosphate (CHEBI:15703) has role Escherichia coli metabolite (CHEBI:76971) |
| α-maltose 6'-phosphate (CHEBI:15703) is a maltose 6'-phosphate (CHEBI:111006) |
| α-maltose 6'-phosphate (CHEBI:15703) is conjugate acid of α-maltose 6'-phosphate(2−) (CHEBI:57478) |
| Incoming Relation(s) |
| α-maltose 6'-phosphate(2−) (CHEBI:57478) is conjugate base of α-maltose 6'-phosphate (CHEBI:15703) |
| IUPAC Name |
|---|
| α-D-glucopyranosyl-(1→4)-D-glucose 6'-(dihydrogen phosphate) |
| Synonym | Source |
|---|---|
| Maltose 6'-phosphate | KEGG COMPOUND |