EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N6S2 |
| Net Charge | 0 |
| Average Mass | 380.502 |
| Monoisotopic Mass | 380.08779 |
| SMILES | N#CC(=C(/N)Sc1ccccc1N)/C(C#N)=C(\N)Sc1ccccc1N |
| InChI | InChI=1S/C18H16N6S2/c19-9-11(17(23)25-15-7-3-1-5-13(15)21)12(10-20)18(24)26-16-8-4-2-6-14(16)22/h1-8H,21-24H2/b17-11+,18-12+ |
| InChIKey | DVEXZJFMOKTQEZ-JYFOCSDGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | osteogenesis regulator Any compound that induces or regulates osteogenesis. EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| U0126 (CHEBI:90693) has role antineoplastic agent (CHEBI:35610) |
| U0126 (CHEBI:90693) has role antioxidant (CHEBI:22586) |
| U0126 (CHEBI:90693) has role apoptosis inducer (CHEBI:68495) |
| U0126 (CHEBI:90693) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| U0126 (CHEBI:90693) has role osteogenesis regulator (CHEBI:63054) |
| U0126 (CHEBI:90693) has role vasoconstrictor agent (CHEBI:50514) |
| U0126 (CHEBI:90693) is a aryl sulfide (CHEBI:35683) |
| U0126 (CHEBI:90693) is a dinitrile (CHEBI:51308) |
| U0126 (CHEBI:90693) is a enamine (CHEBI:47989) |
| U0126 (CHEBI:90693) is a substituted aniline (CHEBI:48975) |
| Incoming Relation(s) |
| U0126.EtOH (CHEBI:90692) has part U0126 (CHEBI:90693) |
| IUPAC Name |
|---|
| (2Z,3Z)-bis{amino[(2-aminophenyl)sulfanyl]methylene}succinonitrile |
| Synonyms | Source |
|---|---|
| FT-1069-1 | ChemIDplus |
| U 0126 | ChemIDplus |
| U-0126 | ChemIDplus |
| U0126 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| U0126 | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3483750 | Reaxys |
| CAS:109511-58-2 | ChemIDplus |
| CAS:218601-62-8 | ChemIDplus |
| Citations |
|---|