EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO5 |
| Net Charge | -2 |
| Average Mass | 187.151 |
| Monoisotopic Mass | 187.04917 |
| SMILES | CC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/p-2/t5-/m0/s1 |
| InChIKey | RFMMMVDNIPUKGG-YFKPBYRVSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS149) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-glutamate(2−) (CHEBI:44337) has functional parent L-glutamate(2−) (CHEBI:29988) |
| N-acetyl-L-glutamate(2−) (CHEBI:44337) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| N-acetyl-L-glutamate(2−) (CHEBI:44337) has role human metabolite (CHEBI:77746) |
| N-acetyl-L-glutamate(2−) (CHEBI:44337) is a N-acetyl-L-α-amino acid anion (CHEBI:233443) |
| N-acetyl-L-glutamate(2−) (CHEBI:44337) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-acetyl-L-glutamate(2−) (CHEBI:44337) is a dicarboxylic acid dianion (CHEBI:28965) |
| N-acetyl-L-glutamate(2−) (CHEBI:44337) is conjugate base of N-acetyl-L-glutamate(1−) (CHEBI:21549) |
| N-acetyl-L-glutamate(2−) (CHEBI:44337) is enantiomer of N-acetyl-D-glutamate(2−) (CHEBI:195260) |
| Incoming Relation(s) |
| N-acetyl-L-glutamate(1−) (CHEBI:21549) is conjugate acid of N-acetyl-L-glutamate(2−) (CHEBI:44337) |
| N-acetyl-D-glutamate(2−) (CHEBI:195260) is enantiomer of N-acetyl-L-glutamate(2−) (CHEBI:44337) |
| N-terminal N-acetyl-L-glutamate residue (CHEBI:140857) is substituent group from N-acetyl-L-glutamate(2−) (CHEBI:44337) |
| IUPAC Name |
|---|
| (2S)-2-acetamidopentanedioate |
| Synonyms | Source |
|---|---|
| acetyl-L-glutamate | MetaCyc |
| (S)-2-(acetylamino)pentanedioate | ChEBI |
| N-Acetyl-L-glutamate | KEGG COMPOUND |
| NAG | MetaCyc |
| UniProt Name | Source |
|---|---|
| N-acetyl-L-glutamate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| ACETYL-GLU | MetaCyc |
| C00624 | KEGG COMPOUND |
| HMDB0001138 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1188-37-0 | KEGG COMPOUND |
| Citations |
|---|