EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC1(C)C(=O)[C@@]2(C)CC[C@@H]1C2 |
| InChI | InChI=1S/C10H16O/c1-9(2)7-4-5-10(3,6-7)8(9)11/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
| InChIKey | LHXDLQBQYFFVNW-XCBNKYQSSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,4R)-fenchone (CHEBI:165) is a fenchone (CHEBI:4999) |
| (1S,4R)-fenchone (CHEBI:165) is enantiomer of (1R,4S)-fenchone (CHEBI:36612) |
| Incoming Relation(s) |
| (1R,4S)-fenchone (CHEBI:36612) is enantiomer of (1S,4R)-fenchone (CHEBI:165) |
| IUPAC Name |
|---|
| (1S,4R)-fenchan-2-one |
| Synonyms | Source |
|---|---|
| (1S,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-one | IUPAC |
| (1S,4R)-(+)-2-fenchanone | ChEBI |
| (1S,4R)-2-fenchanone | ChEBI |
| (1S,4R)-(+)-fenchan-2-one | ChEBI |
| (1S,4R)-fenchan-2-one | ChEBI |
| (1S,4R)-(+)-fenchone | ChEBI |
| UniProt Name | Source |
|---|---|
| (1S,4R)-fenchone | UniProt |