EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | [H]C(=O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[o121h]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5+/m1/s1 |
| InChIKey | PYMYPHUHKUWMLA-WISUUJSJSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldehydo-L-xylose (CHEBI:17979) is a L-xylose (CHEBI:65328) |
| IUPAC Name |
|---|
| L-xylose |
| Synonyms | Source |
|---|---|
| L-Xylose | KEGG COMPOUND |
| L(+)-Xylose | ChemIDplus |
| L-xylo-pentose | IUPAC |
| L-Xyl | JCBN |
| L-Xylofuranose | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| L-xylose | UniProt |
| Citations |
|---|