EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4+,5-,6+/m0/s1 |
| InChIKey | WQZGKKKJIJFFOK-SXUWKVJYSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-galactose (CHEBI:42905) is a L-galactopyranose (CHEBI:37619) |
| α-L-galactose (CHEBI:42905) is enantiomer of α-D-galactose (CHEBI:28061) |
| Incoming Relation(s) |
| 3,6-anhydro-α-L-galactopyranose (CHEBI:83433) has functional parent α-L-galactose (CHEBI:42905) |
| α-L-Fucp-(1→2)-α-L-Galp (CHEBI:147958) has functional parent α-L-galactose (CHEBI:42905) |
| α-L-galactoside (CHEBI:75776) has functional parent α-L-galactose (CHEBI:42905) |
| α-D-galactose (CHEBI:28061) is enantiomer of α-L-galactose (CHEBI:42905) |
| IUPAC Name |
|---|
| α-L-galactopyranose |
| Synonym | Source |
|---|---|
| L-Galactose | KEGG COMPOUND |