EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9Cl3 |
| Net Charge | 0 |
| Average Mass | 283.585 |
| Monoisotopic Mass | 281.97698 |
| SMILES | ClC=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H9Cl3/c15-9-14(10-1-5-12(16)6-2-10)11-3-7-13(17)8-4-11/h1-9H |
| InChIKey | LNKQQZFLNUVWQQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-chloro-2,2-bis(4'-chlorophenyl)ethylene (CHEBI:27454) has role environmental contaminant (CHEBI:78298) |
| 1-chloro-2,2-bis(4'-chlorophenyl)ethylene (CHEBI:27454) is a chlorophenylethylene (CHEBI:23155) |
| 1-chloro-2,2-bis(4'-chlorophenyl)ethylene (CHEBI:27454) is a monochlorobenzenes (CHEBI:83403) |
| Synonyms | Source |
|---|---|
| 1,1-bis(4-chlorophenyl)-2-chloroethylene | ChEBI |
| 1,1-Bis(p-chlorophenyl)-2-chloroethene | ChemIDplus |
| 1,1-Bis(p-chlorophenyl)-2-chloroethylene | ChemIDplus |
| 1-Chloro-2,2-bis(4'-chlorophenyl)ethylene | KEGG COMPOUND |
| 1-Chloro-2,2-bis(4'-chlorophenyl)ethylene | KEGG COMPOUND |
| 1-Chloro-2,2-bis(p-chlorophenyl)ethylene | ChemIDplus |
| Citations |
|---|