EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13O8P |
| Net Charge | 0 |
| Average Mass | 232.125 |
| Monoisotopic Mass | 232.03480 |
| SMILES | O=P(O)(O)OC[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H13O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h3-9H,1-2H2,(H2,10,11,12)/t3-,4-,5-/m1/s1 |
| InChIKey | VJDOAZKNBQCAGE-UOWFLXDJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-arabinitol 1-phosphate (CHEBI:28455) has functional parent D-arabinitol (CHEBI:18333) |
| D-arabinitol 1-phosphate (CHEBI:28455) has functional parent L-arabinitol (CHEBI:18403) |
| D-arabinitol 1-phosphate (CHEBI:28455) is a alditol 5-phosphate (CHEBI:22295) |
| D-arabinitol 1-phosphate (CHEBI:28455) is a arabinitol phosphate (CHEBI:22593) |
| D-arabinitol 1-phosphate (CHEBI:28455) is conjugate acid of D-arabinitol 1-phosphate(2−) (CHEBI:58566) |
| Incoming Relation(s) |
| D-arabinitol 1-phosphate(2−) (CHEBI:58566) is conjugate base of D-arabinitol 1-phosphate (CHEBI:28455) |
| IUPAC Name |
|---|
| D-arabinitol 1-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 1-O-phosphono-D-arabinitol | IUPAC |
| 5-O-phosphono-L-arabinitol | ChEBI |
| L-Arabinitol 5-phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03509 | KEGG COMPOUND |