EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17N5O6S2 |
| Net Charge | 0 |
| Average Mass | 427.464 |
| Monoisotopic Mass | 427.06203 |
| SMILES | [H][C@]12SCC(COC)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C15H17N5O6S2/c1-25-3-6-4-27-13-9(12(22)20(13)10(6)14(23)24)18-11(21)8(19-26-2)7-5-28-15(16)17-7/h5,9,13H,3-4H2,1-2H3,(H2,16,17)(H,18,21)(H,23,24)/b19-8-/t9-,13-/m1/s1 |
| InChIKey | WYUSVOMTXWRGEK-HBWVYFAYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefpodoxime (CHEBI:3504) has role antibacterial drug (CHEBI:36047) |
| cefpodoxime (CHEBI:3504) is a carboxylic acid (CHEBI:33575) |
| cefpodoxime (CHEBI:3504) is a cephalosporin (CHEBI:23066) |
| Incoming Relation(s) |
| cefpodoxime proxetil (CHEBI:3505) has functional parent cefpodoxime (CHEBI:3504) |
| IUPAC Name |
|---|
| 7β-[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-3-(methoxymethyl)-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefpodoxima | ChemIDplus |
| cefpodoxime | ChemIDplus |
| cefpodoximum | ChemIDplus |
| Synonym | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 2968 | VSDB |
| C08114 | KEGG COMPOUND |
| Cefpodoxime | Wikipedia |
| D07650 | KEGG DRUG |
| DB01416 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6021381 | Reaxys |
| CAS:80210-62-4 | KEGG COMPOUND |
| CAS:80210-62-4 | ChemIDplus |
| Citations |
|---|