EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O6 |
| Net Charge | 0 |
| Average Mass | 404.503 |
| Monoisotopic Mass | 404.21989 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(C)=O)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C23H32O6/c1-13(24)29-12-19(27)23(28)9-7-17-16-5-4-14-10-15(25)6-8-21(14,2)20(16)18(26)11-22(17,23)3/h10,16-18,20,26,28H,4-9,11-12H2,1-3H3/t16-,17-,18-,20+,21-,22-,23-/m0/s1 |
| InChIKey | ALEXXDVDDISNDU-JZYPGELDSA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cortisol 21-acetate (CHEBI:17609) has role anti-inflammatory agent (CHEBI:67079) |
| cortisol 21-acetate (CHEBI:17609) has role antidepressant (CHEBI:35469) |
| cortisol 21-acetate (CHEBI:17609) has role dermatologic drug (CHEBI:50177) |
| cortisol 21-acetate (CHEBI:17609) is a cortisol ester (CHEBI:23396) |
| cortisol 21-acetate (CHEBI:17609) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 11β,17-dihydroxy-3,20-dioxopregn-4-en-21-yl acetate |
| Synonyms | Source |
|---|---|
| 21-O-acetylcortisol | JCBN |
| Cortell | KEGG COMPOUND |
| Cortisol 21-acetate | KEGG COMPOUND |
| cortisol acetate | ChEBI |
| hydrocortisone 21-acetate | ChEBI |
| hydrocortisone acetate | ChEMBL |
| Brand Names | Source |
|---|---|
| Barquinol hc | ChEMBL |
| Chloromycetin hydrocort | ChEMBL |
| Colifoam | ChEMBL |
| Cortucid | ChEMBL |
| Epifoam | ChEMBL |
| Framycort | ChEMBL |
| UniProt Name | Source |
|---|---|
| cortisol 21-acetate | UniProt |
| Citations |
|---|