EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O4S |
| Net Charge | 0 |
| Average Mass | 180.225 |
| Monoisotopic Mass | 180.04563 |
| SMILES | CSC[C@@H](O)[C@@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C6H12O4S/c1-11-3-5(9)6(10)4(8)2-7/h2,4-6,8-10H,3H2,1H3/t4-,5+,6-/m0/s1 |
| InChIKey | ACWASDPGAVYCNI-JKUQZMGJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-methyl-5-thio-D-ribose (CHEBI:16895) has functional parent D-ribose (CHEBI:16988) |
| S-methyl-5-thio-D-ribose (CHEBI:16895) has role metabolite (CHEBI:25212) |
| S-methyl-5-thio-D-ribose (CHEBI:16895) is a thioribose (CHEBI:26976) |
| IUPAC Name |
|---|
| 5-S-methyl-5-thio-D-ribose |
| Synonyms | Source |
|---|---|
| 5-Deoxy-5-(methylthio)ribose | ChemIDplus |
| 5-Methylthio-D-ribose | KEGG COMPOUND |
| 5-Methylthioribose | ChemIDplus |
| S(5)-methyl-5-thio-D-ribose | ChEBI |
| S-Methyl-5-thio-D-ribose | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| aldehydo S-methyl-5-thio-D-ribose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-560 | MetaCyc |
| HMDB0001087 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723722 | Reaxys |
| CAS:23656-67-9 | ChemIDplus |
| Citations |
|---|