EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H30O8 |
| Net Charge | 0 |
| Average Mass | 518.562 |
| Monoisotopic Mass | 518.19407 |
| SMILES | [H]C(=O)c1c(O)c(O)c(C(C)C)c2cc(C)c(-c3c(C)cc4c(C(C)C)c(O)c(O)c(C([H])=O)c4c3O)c(O)c12 |
| InChI | InChI=1S/C30H30O8/c1-11(2)19-15-7-13(5)21(27(35)23(15)17(9-31)25(33)29(19)37)22-14(6)8-16-20(12(3)4)30(38)26(34)18(10-32)24(16)28(22)36/h7-12,33-38H,1-6H3 |
| InChIKey | QBKSWRVVCFFDOT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antispermatogenic agent An agent that destroy spermatozoa in the male genitalia and block spermatogenesis. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gossypol (CHEBI:28584) has role anti-inflammatory agent (CHEBI:67079) |
| gossypol (CHEBI:28584) has role antispermatogenic agent (CHEBI:145047) |
| gossypol (CHEBI:28584) has role plant metabolite (CHEBI:76924) |
| gossypol (CHEBI:28584) is a aldehyde (CHEBI:17478) |
| gossypol (CHEBI:28584) is a hexol (CHEBI:37206) |
| gossypol (CHEBI:28584) is a hydroxynaphthalene (CHEBI:24727) |
| gossypol (CHEBI:28584) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 1,1',6,6',7,7'-hexahydroxy-3,3'-dimethyl-5,5'-di(propan-2-yl)[2,2'-binaphthalene]-8,8'-dicarbaldehyde |
| Synonyms | Source |
|---|---|
| 1,1',6,6',7,7'-hexahydroxy-3,3'-dimethyl-5,5'-bis(1-methylethyl)[2,2'-binaphthalene]-8,8'-dicarboxaldehyde | ChEBI |
| 1,1',6,6',7,7'-hexahydroxy-3,3'-dimethyl-5,5'-diisopropyl[2,2'-binaphthalene]-8,8'-dicarboxaldehyde | ChEBI |
| 1,1',6,6',7,7'-hexahydroxy-3,3'-dimethyl-5,5'-diisopropyl-2,2'-binaphthyl-8,8'-dialdehyde | ChEBI |
| 1,1',6,6',7,7'-hexahydroxy-5,5'-diisopropyl-3,3'-dimethyl-[2,2'-binaphthalene]-8,8'-dicarbaldehyde | ChEBI |
| 1,1',6,6',7,7'-hexahydroxy-5,5'-diisopropyl-3,3'-dimethyl-2,2'-binaphthalene-8,8'-dicarboxaldehyde | ChEBI |
| 1,6,7,1',6',7'-hexahydroxy-5,5'-diisopropyl-3,3'-dimethyl-[2,2']binaphthalenyl-8,8'-dicarboxaldehyde | ChEBI |
| Citations |
|---|