EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O5 |
| Net Charge | 0 |
| Average Mass | 332.396 |
| Monoisotopic Mass | 332.16237 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]23CCC[C@@]1(C)C(=O)O3 |
| InChI | InChI=1S/C19H24O5/c1-10-8-17-9-18(10,23)7-4-11(17)19-6-3-5-16(2,15(22)24-19)13(19)12(17)14(20)21/h11-13,23H,1,3-9H2,2H3,(H,20,21)/t11-,12-,13-,16-,17+,18+,19-/m1/s1 |
| InChIKey | OXFPYCSNYOFUCH-KQBHUUJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gibberella fujikuroi (ncbitaxon:5127) | - | PubMed (24232845) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A20 (CHEBI:27742) has role mouse metabolite (CHEBI:75771) |
| gibberellin A20 (CHEBI:27742) has role plant metabolite (CHEBI:76924) |
| gibberellin A20 (CHEBI:27742) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A20 (CHEBI:27742) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A20 (CHEBI:27742) is a lactone (CHEBI:25000) |
| gibberellin A20 (CHEBI:27742) is conjugate acid of gibberellin A20(1−) (CHEBI:58526) |
| Incoming Relation(s) |
| gibberellin A20 methyl ester (CHEBI:73257) has functional parent gibberellin A20 (CHEBI:27742) |
| gibberellin A20(1−) (CHEBI:58526) is conjugate base of gibberellin A20 (CHEBI:27742) |
| IUPAC Names |
|---|
| (1R,2R,5S,8S,9S,10R,11R)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| 7α-hydroxy-1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibbane-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| GA20 | ChEBI |
| Gibberellin 20 | KEGG COMPOUND |
| Gibberellin 20 | KEGG COMPOUND |
| Gibberellin A20 | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| gibberellin-20 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000020 | KNApSAcK |
| C02035 | KEGG COMPOUND |
| LMPR0104170004 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8732051 | Reaxys |
| CAS:19143-87-4 | KEGG COMPOUND |
| CAS:19143-87-4 | ChemIDplus |
| Citations |
|---|