EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2 |
| Net Charge | 0 |
| Average Mass | 169.184 |
| Monoisotopic Mass | 169.08513 |
| SMILES | CN[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C7H11N3O2/c1-8-6(7(11)12)2-5-3-9-4-10-5/h3-4,6,8H,2H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | CYZKJBZEIFWZSR-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-methyl-L-histidine (CHEBI:50601) is a Nα-methyl-L-histidines (CHEBI:21911) |
| Nα-methyl-L-histidine (CHEBI:50601) is tautomer of Nα-methyl-L-histidine zwitterion (CHEBI:75895) |
| Incoming Relation(s) |
| Nα-methyl-L-histidine residue (CHEBI:195204) is substituent group from Nα-methyl-L-histidine (CHEBI:50601) |
| Nα-methyl-L-histidine zwitterion (CHEBI:75895) is tautomer of Nα-methyl-L-histidine (CHEBI:50601) |
| IUPAC Names |
|---|
| (2S)-3-(1H-imidazol-4-yl)-2-(methylamino)propanoic acid |
| N-methyl-L-histidine |
| Synonyms | Source |
|---|---|
| Nalpha-Methylhistidine | KEGG COMPOUND |
| N-Methyl-L-histidine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:84027 | Reaxys |
| CAS:24886-03-1 | KEGG COMPOUND |
| CAS:24886-03-1 | ChemIDplus |