EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | OC1C=Cc2ccccc2C1O |
| InChI | InChI=1S/C10H10O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,9-12H |
| InChIKey | QPUHWUSUBHNZCG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dihydronaphthalene-1,2-diol (CHEBI:28516) has functional parent naphthalene-1,2-diol (CHEBI:17435) |
| 1,2-dihydronaphthalene-1,2-diol (CHEBI:28516) has parent hydride 1,2-dihydronaphthalene (CHEBI:38142) |
| 1,2-dihydronaphthalene-1,2-diol (CHEBI:28516) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 1,2-dihydronaphthalene-1,2-diol (CHEBI:28516) has role mouse metabolite (CHEBI:75771) |
| 1,2-dihydronaphthalene-1,2-diol (CHEBI:28516) is a dihydronaphthalenes (CHEBI:90740) |
| 1,2-dihydronaphthalene-1,2-diol (CHEBI:28516) is a naphthalenediols (CHEBI:23783) |
| Incoming Relation(s) |
| cis-1,2-dihydronaphthalene-1,2-diol (CHEBI:15561) is a 1,2-dihydronaphthalene-1,2-diol (CHEBI:28516) |
| trans-1,2-dihydronaphthalene-1,2-diol (CHEBI:27039) is a 1,2-dihydronaphthalene-1,2-diol (CHEBI:28516) |
| IUPAC Name |
|---|
| 1,2-dihydronaphthalene-1,2-diol |
| Synonyms | Source |
|---|---|
| 1,2-Dihydronaphthalene-1,2-diol | KEGG COMPOUND |
| 1,2-Dihydroxy-1,2-dihydronaphthalene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06205 | KEGG COMPOUND |
| HMDB0060335 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2045863 | Beilstein |
| CAS:7234-04-0 | ChemIDplus |
| Citations |
|---|