EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N5O |
| Net Charge | 0 |
| Average Mass | 209.253 |
| Monoisotopic Mass | 209.12766 |
| SMILES | Nc1cc(N2CCCCC2)nc(N)[n+]1[O-] |
| InChI | InChI=1S/C9H15N5O/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13/h6H,1-5,10H2,(H2,11,12) |
| InChIKey | ZFMITUMMTDLWHR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minoxidil (CHEBI:6942) has role antihypertensive agent (CHEBI:35674) |
| minoxidil (CHEBI:6942) has role vasodilator agent (CHEBI:35620) |
| minoxidil (CHEBI:6942) is a aminopyrimidine (CHEBI:38338) |
| minoxidil (CHEBI:6942) is a piperidines (CHEBI:26151) |
| minoxidil (CHEBI:6942) is a pyrimidine N-oxide (CHEBI:50698) |
| IUPAC Name |
|---|
| 6-(piperidin-1-yl)pyrimidine-2,4-diamine 3-oxide |
| INNs | Source |
|---|---|
| minoxidil | WHO MedNet |
| minoxidil | ChemIDplus |
| minoxidil | WHO MedNet |
| minoxidilum | ChemIDplus |
| Brand Names | Source |
|---|---|
| Alostil | DrugBank |
| Apo-Gain | DrugBank |
| Loniten | DrugBank |
| Lonolox | DrugBank |
| Minoximen | DrugBank |
| Normoxidil | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1814 | DrugCentral |
| AU2012316063 | Patent |
| D00418 | KEGG DRUG |
| DB00350 | DrugBank |
| HMDB0014494 | HMDB |
| Minoxidil | Wikipedia |
| Minoxidil | Wikipedia |
| NL6615385 | Patent |
| RU2012112099 | Patent |
| US3382247 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:886240 | Reaxys |
| CAS:38304-91-5 | KEGG DRUG |
| CAS:38304-91-5 | ChemIDplus |
| Citations |
|---|