EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2O4 |
| Net Charge | 0 |
| Average Mass | 146.102 |
| Monoisotopic Mass | 146.03276 |
| SMILES | NC(=O)NC(=O)CC(=O)O |
| InChI | InChI=1S/C4H6N2O4/c5-4(10)6-2(7)1-3(8)9/h1H2,(H,8,9)(H3,5,6,7,10) |
| InChIKey | UCUUMUFWVSUBOL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxo-3-ureidopropanoic acid (CHEBI:49049) has functional parent malonic acid (CHEBI:30794) |
| 3-oxo-3-ureidopropanoic acid (CHEBI:49049) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| 3-oxo-3-ureidopropanoic acid (CHEBI:49049) is conjugate acid of 3-oxo-3-ureidopropanoate (CHEBI:58775) |
| Incoming Relation(s) |
| 3-oxo-3-ureidopropanoate (CHEBI:58775) is conjugate base of 3-oxo-3-ureidopropanoic acid (CHEBI:49049) |
| IUPAC Name |
|---|
| 3-(carbamoylamino)-3-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| 3-Oxo-3-ureidopropanoate | KEGG COMPOUND |
| Malonuric acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15607 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7525991 | Beilstein |