EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO9 |
| Net Charge | 0 |
| Average Mass | 309.271 |
| Monoisotopic Mass | 309.10598 |
| SMILES | [H][C@@]1([C@H](O)[C@H](O)CO)O[C@@](O)(C(=O)O)C[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C11H19NO9/c1-4(14)12-7-5(15)2-11(20,10(18)19)21-9(7)8(17)6(16)3-13/h5-9,13,15-17,20H,2-3H2,1H3,(H,12,14)(H,18,19)/t5-,6+,7+,8+,9+,11+/m0/s1 |
| InChIKey | SQVRNKJHWKZAKO-YRMXFSIDSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-α-neuraminic acid (CHEBI:49026) has functional parent α-neuraminic acid (CHEBI:49024) |
| N-acetyl-α-neuraminic acid (CHEBI:49026) has role epitope (CHEBI:53000) |
| N-acetyl-α-neuraminic acid (CHEBI:49026) is a N-acetylneuraminic acid (CHEBI:17012) |
| N-acetyl-α-neuraminic acid (CHEBI:49026) is conjugate acid of N-acetyl-α-neuraminate (CHEBI:58770) |
| Incoming Relation(s) |
| N-acetyl-α-neuraminyl-(2→6)-N-acetyl-α-D-galactosamine (CHEBI:61818) has functional parent N-acetyl-α-neuraminic acid (CHEBI:49026) |
| N-acetyl-α-neuraminate (CHEBI:58770) is conjugate base of N-acetyl-α-neuraminic acid (CHEBI:49026) |
| IUPAC Name |
|---|
| 5-acetamido-3,5-dideoxy-D-glycero-α-D-galacto-non-2-ulopyranosonic acid |
| Synonyms | Source |
|---|---|
| 5-(acetylamino)-3,5-dideoxy-D-glycero-α-D-galacto-2-nonulopyranosonic acid | ChEBI |
| O-SIALIC ACID | PDBeChem |
| D-glycero-α-D-galacto-2-nonulopyranosonic acid, 5-(acetylamino)-3,5-dideoxy- | ChEBI |
| α-Neu5Ac | ChEBI |
| Citations |
|---|