EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O6 |
| Net Charge | 0 |
| Average Mass | 464.643 |
| Monoisotopic Mass | 464.31379 |
| SMILES | [H][C@@]12C[C@@H](O)[C@@H](O)C[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@](O)(CC[C@]3([H])[C@H](C)[C@H](O)CCC(C)(C)O)C1=CC2=O |
| InChI | InChI=1S/C27H44O6/c1-15(20(28)8-9-24(2,3)32)16-7-11-27(33)18-12-21(29)19-13-22(30)23(31)14-25(19,4)17(18)6-10-26(16,27)5/h12,15-17,19-20,22-23,28,30-33H,6-11,13-14H2,1-5H3/t15-,16+,17-,19-,20+,22+,23-,25+,26+,27+/m0/s1 |
| InChIKey | UPEZCKBFRMILAV-JMZLNJERSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | prohormone Any intra-glandular substance that acts as a precursor of a hormone, usually having minimal hormonal effect itself. Prohormones generally help in amplifying the effect of existing hormones. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ecdysone (CHEBI:16688) has parent hydride 5β-cholestane (CHEBI:35517) |
| ecdysone (CHEBI:16688) has role prohormone (CHEBI:71212) |
| ecdysone (CHEBI:16688) is a 14α-hydroxy steroid (CHEBI:36861) |
| ecdysone (CHEBI:16688) is a 22-hydroxy steroid (CHEBI:36863) |
| ecdysone (CHEBI:16688) is a 25-hydroxy steroid (CHEBI:36864) |
| ecdysone (CHEBI:16688) is a 2β-hydroxy steroid (CHEBI:36859) |
| ecdysone (CHEBI:16688) is a 3β-sterol (CHEBI:35348) |
| ecdysone (CHEBI:16688) is a 6-oxo steroid (CHEBI:36883) |
| ecdysone (CHEBI:16688) is a ecdysteroid (CHEBI:23897) |
| Incoming Relation(s) |
| (24R)-11α,20,24-trihydroxyecdysone (CHEBI:18531) has functional parent ecdysone (CHEBI:16688) |
| (25R)-11α,20,26-trihydroxyecdysone (CHEBI:18532) has functional parent ecdysone (CHEBI:16688) |
| (25S)-11α,20,26-trihydroxyecdysone (CHEBI:46739) has functional parent ecdysone (CHEBI:16688) |
| 2-dehydroecdysone (CHEBI:19544) has functional parent ecdysone (CHEBI:16688) |
| 2-deoxyecdysone (CHEBI:19566) has functional parent ecdysone (CHEBI:16688) |
| 2,22,25-trideoxyecdysone (CHEBI:19290) has functional parent ecdysone (CHEBI:16688) |
| 20-hydroxyecdysone (CHEBI:16587) has functional parent ecdysone (CHEBI:16688) |
| 20,26-dihydroxyecdysone (CHEBI:19793) has functional parent ecdysone (CHEBI:16688) |
| 22-deoxy-20,21-dihydroxyecdysone (CHEBI:19804) has functional parent ecdysone (CHEBI:16688) |
| 22-deoxyecdysone (CHEBI:232767) has functional parent ecdysone (CHEBI:16688) |
| 25-deoxyecdysone (CHEBI:19814) has functional parent ecdysone (CHEBI:16688) |
| 3-dehydroecdysone (CHEBI:17058) has functional parent ecdysone (CHEBI:16688) |
| ecdysone 25-O-D-glucopyranoside (CHEBI:23890) has functional parent ecdysone (CHEBI:16688) |
| ecdysteroid ester (CHEBI:23895) has functional parent ecdysone (CHEBI:16688) |
| IUPAC Name |
|---|
| (2β,3β,5β,22R)-2,3,14,22,25-pentahydroxycholest-7-en-6-one |
| Synonyms | Source |
|---|---|
| (22R)-2β,3β,14,22,25-pentahydroxy-5β-cholest-7-en-6-one | IUPAC |
| (22R)-2beta,3beta,14alpha,22,25-pentahydroxy-5beta-cholest-7-en-6-one | ChEBI |
| Ecdysone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| ecdysone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003651 | KNApSAcK |
| C00477 | KEGG COMPOUND |
| C00477 | KEGG COMPOUND |
| Ecdysone | Wikipedia |
| LMST01010210 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2422986 | Reaxys |
| CAS:3604-87-3 | KEGG COMPOUND |
| Citations |
|---|