EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O2 |
| Net Charge | 0 |
| Average Mass | 136.150 |
| Monoisotopic Mass | 136.05243 |
| SMILES | Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H8O2/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | LPNBBFKOUUSUDB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-toluic acid (CHEBI:36635) is a methylbenzoic acid (CHEBI:25280) |
| p-toluic acid (CHEBI:36635) is conjugate acid of p-toluate (CHEBI:28856) |
| Incoming Relation(s) |
| p-toluate (CHEBI:28856) is conjugate base of p-toluic acid (CHEBI:36635) |
| IUPAC Name |
|---|
| 4-methylbenzoic acid |
| Synonyms | Source |
|---|---|
| p-Toluic acid | KEGG COMPOUND |
| 4-Methylbenzoic acid | KEGG COMPOUND |
| Toluenecarboxylic acid | KEGG COMPOUND |
| Crithminic acid | KEGG COMPOUND |
| 4-Toluic acid | ChemIDplus |
| p-Carboxytoluene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C01454 | KEGG COMPOUND |
| 4MA | PDBeChem |
| P-toluic_acid | Wikipedia |
| HMDB0029635 | HMDB |
| Citations |
|---|