EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15O9P |
| Net Charge | 0 |
| Average Mass | 262.151 |
| Monoisotopic Mass | 262.04537 |
| SMILES | O=P(O)(O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H15O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3-11H,1-2H2,(H2,12,13,14)/t3-,4+,5+,6+/m0/s1 |
| InChIKey | GACTWZZMVMUKNG-SLPGGIOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucitol 6-phosphate (CHEBI:17044) has functional parent D-glucitol (CHEBI:17924) |
| D-glucitol 6-phosphate (CHEBI:17044) has role Escherichia coli metabolite (CHEBI:76971) |
| D-glucitol 6-phosphate (CHEBI:17044) has role mouse metabolite (CHEBI:75771) |
| D-glucitol 6-phosphate (CHEBI:17044) is a alditol 6-phosphate (CHEBI:35375) |
| D-glucitol 6-phosphate (CHEBI:17044) is a glucitol phosphate (CHEBI:26725) |
| D-glucitol 6-phosphate (CHEBI:17044) is conjugate acid of D-glucitol 6-phosphate(2−) (CHEBI:60084) |
| Incoming Relation(s) |
| D-glucitol 6-phosphate(2−) (CHEBI:60084) is conjugate base of D-glucitol 6-phosphate (CHEBI:17044) |
| IUPAC Names |
|---|
| 6-O-phosphono-D-glucitol |
| D-glucitol 6-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| D-Glucitol, 6-(dihydrogen phosphate) | ChemIDplus |
| D-Glucitol 6-phosphate | KEGG COMPOUND |
| D-Sorbitol 6-phosphate | KEGG COMPOUND |
| D-Sorbitol 6-phosphate | KEGG COMPOUND |
| Sorbitol 6-phosphate | KEGG COMPOUND |
| Sorbitol-6-phosphate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1728363 | Beilstein |
| CAS:20479-58-7 | ChemIDplus |