EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N3O |
| Net Charge | 0 |
| Average Mass | 123.115 |
| Monoisotopic Mass | 123.04326 |
| SMILES | NC(=O)c1cnccn1 |
| InChI | InChI=1S/C5H5N3O/c6-5(9)4-3-7-1-2-8-4/h1-3H,(H2,6,9) |
| InChIKey | IPEHBUMCGVEMRF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Applications: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrazinecarboxamide (CHEBI:45285) has role antitubercular agent (CHEBI:33231) |
| pyrazinecarboxamide (CHEBI:45285) has role prodrug (CHEBI:50266) |
| pyrazinecarboxamide (CHEBI:45285) is a N-acylammonia (CHEBI:83628) |
| pyrazinecarboxamide (CHEBI:45285) is a monocarboxylic acid amide (CHEBI:29347) |
| pyrazinecarboxamide (CHEBI:45285) is a pyrazines (CHEBI:38314) |
| Incoming Relation(s) |
| N-butyl-5-(4-hydroxyphenyl)-6-oxo-1,6-dihydropyrazine-2-carboxamide (CHEBI:167182) is a pyrazinecarboxamide (CHEBI:45285) |
| IUPAC Name |
|---|
| pyrazine-2-carboxamide |
| INNs | Source |
|---|---|
| pyrazinamida | WHO MedNet |
| pyrazinamidum | WHO MedNet |
| pyrazinamide | WHO MedNet |
| pyrazinamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Pyrazinamide | KEGG COMPOUND |
| Pyrazinoic acid amide | KEGG COMPOUND |
| 2-carbamylpyrazine | ChemIDplus |
| pyrazine carboxamide | NIST Chemistry WebBook |
| 2-pyrazinecarboxamide | ChemIDplus |
| PYRAZINE-2-CARBOXAMIDE | PDBeChem |
| UniProt Name | Source |
|---|---|
| pyrazinamide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01956 | KEGG COMPOUND |
| PZA | PDBeChem |
| Pyrazinamide | Wikipedia |
| DB00339 | DrugBank |
| HMDB0014483 | HMDB |
| D00144 | KEGG DRUG |
| LSM-5425 | LINCS |
| 2328 | DrugCentral |
| Citations |
|---|