EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46O2 |
| Net Charge | 0 |
| Average Mass | 450.707 |
| Monoisotopic Mass | 450.34978 |
| SMILES | CC1=C(C/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24H,9-17,21H2,1-6H3/b25-20+/t23-,24-/m1/s1 |
| InChIKey | MBWXNTAXLNYFJB-NKFFZRIASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood plasma (BTO:0000118) | PubMed (7657478) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phylloquinone (CHEBI:18067) has role cofactor (CHEBI:23357) |
| phylloquinone (CHEBI:18067) has role human metabolite (CHEBI:77746) |
| phylloquinone (CHEBI:18067) has role plant metabolite (CHEBI:76924) |
| phylloquinone (CHEBI:18067) is a phylloquinones (CHEBI:26106) |
| phylloquinone (CHEBI:18067) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| 2-methyl-3-[(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl]naphthalene-1,4-dione |
| INNs | Source |
|---|---|
| fitomenadiona | WHO MedNet |
| phytomenadione | WHO MedNet |
| phytoménadione | WHO MedNet |
| phytomenadionum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-[(2E)-3,7,11,15-tetramethyl-2-hexadecenyl]naphthoquinone | NIST Chemistry WebBook |
| 2-Methyl-3-(3,7,11,15-tetramethyl-2-hexadecenyl)-1,4-naphthalenedione | ChemIDplus |
| 2-Methyl-3-phytyl-1,4-naphthochinon | ChemIDplus |
| 2-methyl-3-phytyl-1,4-naphthoquinone | KEGG COMPOUND |
| 3-phytylmenadione | ChemIDplus |
| fitomenadione | ChemIDplus |
| Brand Name | Source |
|---|---|
| Mephyton | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| phylloquinone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2843 | DrugCentral |
| 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE | MetaCyc |
| 4447652 | ChemSpider |
| C00002868 | KNApSAcK |
| C02059 | KEGG COMPOUND |
| D00148 | KEGG DRUG |
| DB01022 | DrugBank |
| HMDB0003555 | HMDB |
| LMPR02030028 | LIPID MAPS |
| Phytomenadione | Wikipedia |
| PQN | PDBeChem |
| Citations |
|---|