EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10FNO2 |
| Net Charge | 0 |
| Average Mass | 183.182 |
| Monoisotopic Mass | 183.06956 |
| SMILES | N[C@@H](Cc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C9H10FNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | XWHHYOYVRVGJJY-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-fluorophenyl-L-alanine (CHEBI:44909) is a L-phenylalanine derivative (CHEBI:84144) |
| 4-fluorophenyl-L-alanine (CHEBI:44909) is a 4-fluorophenylalanine (CHEBI:84060) |
| 4-fluorophenyl-L-alanine (CHEBI:44909) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 4-fluorophenyl-L-alanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(4-fluorophenyl)propanoic acid | IUPAC |
| 4-fluoro-L-phenylalanine | PDBeChem |
| L-4-fluorophenylalanine | ChemIDplus |
| p-Fluoro-L-phenylalanine | ChemIDplus |
| 4-Fluorophenylalanine | ChemIDplus |
| S-(-)-p-Fluorophenylalanine | ChemIDplus |
| Citations |
|---|