EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O4 |
| Net Charge | 0 |
| Average Mass | 226.232 |
| Monoisotopic Mass | 226.09536 |
| SMILES | NCc1ncc(CCC(=O)O)c1CC(=O)O |
| InChI | InChI=1S/C10H14N2O4/c11-4-8-7(3-10(15)16)6(5-12-8)1-2-9(13)14/h5,12H,1-4,11H2,(H,13,14)(H,15,16) |
| InChIKey | QSHWIQZFGQKFMA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| porphobilinogen (CHEBI:17381) has role Escherichia coli metabolite (CHEBI:76971) |
| porphobilinogen (CHEBI:17381) has role metabolite (CHEBI:25212) |
| porphobilinogen (CHEBI:17381) has role mouse metabolite (CHEBI:75771) |
| porphobilinogen (CHEBI:17381) is a aralkylamino compound (CHEBI:64365) |
| porphobilinogen (CHEBI:17381) is a dicarboxylic acid (CHEBI:35692) |
| porphobilinogen (CHEBI:17381) is a pyrroles (CHEBI:26455) |
| porphobilinogen (CHEBI:17381) is conjugate acid of porphobilinogen(1−) (CHEBI:58126) |
| Incoming Relation(s) |
| porphobilinogen(1−) (CHEBI:58126) is conjugate base of porphobilinogen (CHEBI:17381) |
| IUPAC Name |
|---|
| 3-[5-(aminomethyl)-4-(carboxymethyl)-1H-pyrrol-3-yl]propanoic acid |
| Synonym | Source |
|---|---|
| Porphobilinogen | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00931 | KEGG COMPOUND |
| PBG | PDBeChem |
| DB02272 | DrugBank |
| HMDB0000245 | HMDB |
| PORPHOBILINOGEN | MetaCyc |
| Porphobilinogen | Wikipedia |
| C00007339 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:220051 | Reaxys |
| CAS:487-90-1 | KEGG COMPOUND |
| CAS:487-90-1 | ChemIDplus |
| Citations |
|---|