EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | CC(=O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c1-3(7)10-2-4(6)5(8)9/h4H,2,6H2,1H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | VZXPDPZARILFQX-BYPYZUCNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS20) | ||
| - | DOI (10.1021/ac300829f) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-acetyl-L-serine (CHEBI:17981) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| O-acetyl-L-serine (CHEBI:17981) has role bacterial metabolite (CHEBI:76969) |
| O-acetyl-L-serine (CHEBI:17981) is a acetate ester (CHEBI:47622) |
| O-acetyl-L-serine (CHEBI:17981) is a acetyl-L-serine (CHEBI:22194) |
| O-acetyl-L-serine (CHEBI:17981) is tautomer of O-acetyl-L-serine zwitterion (CHEBI:58340) |
| Incoming Relation(s) |
| O-acetyl-L-serine residue (CHEBI:141128) is substituent group from O-acetyl-L-serine (CHEBI:17981) |
| O-acetyl-L-serine zwitterion (CHEBI:58340) is tautomer of O-acetyl-L-serine (CHEBI:17981) |
| IUPAC Name |
|---|
| O-acetyl-L-serine |
| Synonyms | Source |
|---|---|
| O-Acetyl-L-serine | KEGG COMPOUND |
| O3-Acetyl-L-serine | KEGG COMPOUND |
| O-acetyl-L-serine | ChEBI |
| O3-acetyl-L-serine | ChEBI |
| L-Serine, acetate (ester) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00979 | KEGG COMPOUND |
| C00979 | KEGG COMPOUND |
| OAS | PDBeChem |
| DB01837 | DrugBank |
| O-Acetylserine | Wikipedia |
| ACETYLSERINE | MetaCyc |
| HMDB0003011 | HMDB |
| C00007459 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723791 | Reaxys |
| CAS:5147-00-2 | KEGG COMPOUND |
| CAS:5147-00-2 | ChemIDplus |
| Citations |
|---|