EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O2 |
| Net Charge | 0 |
| Average Mass | 186.210 |
| Monoisotopic Mass | 186.06808 |
| SMILES | O=C(O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14) |
| InChIKey | PRPINYUDVPFIRX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-naphthaleneacetic acid (CHEBI:32918) has role synthetic auxin (CHEBI:26841) |
| 1-naphthaleneacetic acid (CHEBI:32918) is a naphthylacetic acid (CHEBI:35629) |
| 1-naphthaleneacetic acid (CHEBI:32918) is conjugate acid of 1-naphthaleneacetate (CHEBI:156230) |
| Incoming Relation(s) |
| 1-naphthaleneacetate (CHEBI:156230) is conjugate base of 1-naphthaleneacetic acid (CHEBI:32918) |
| IUPAC Name |
|---|
| naphthalen-1-ylacetic acid |
| Synonyms | Source |
|---|---|
| 1-Naphthylacetic acid | KEGG COMPOUND |
| 1-naphthaleneacetic acid | NIST Chemistry WebBook |
| α-naphthaleneacetic acid | NIST Chemistry WebBook |
| NAPHTHALEN-1-YL-ACETIC ACID | PDBeChem |
| naphthalene-1-acetic acid | NIST Chemistry WebBook |
| NAA | ChemIDplus |
| Citations |
|---|