EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7447 - nafcillin
| Formula | C21H22N2O5S |
| Net Charge | 0 |
| Average Mass | 414.483 |
| Monoisotopic Mass | 414.12494 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)c1c(OCC)ccc2ccccc12 |
| InChI | InChI=1S/C21H22N2O5S/c1-4-28-13-10-9-11-7-5-6-8-12(11)14(13)17(24)22-15-18(25)23-16(20(26)27)21(2,3)29-19(15)23/h5-10,15-16,19H,4H2,1-3H3,(H,22,24)(H,26,27)/t15-,16+,19-/m1/s1 |
| InChIKey | GPXLMGHLHQJAGZ-JTDSTZFVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nafcillin (CHEBI:7447) has role antibacterial drug (CHEBI:36047) |
| nafcillin (CHEBI:7447) is a penicillin (CHEBI:17334) |
| nafcillin (CHEBI:7447) is a penicillin allergen (CHEBI:88187) |
| nafcillin (CHEBI:7447) is conjugate acid of nafcillin(1−) (CHEBI:51918) |
| Incoming Relation(s) |
| nafcillin(1−) (CHEBI:51918) is conjugate base of nafcillin (CHEBI:7447) |
| IUPAC Name |
|---|
| 6β-(2-ethoxynaphthalene-1-carboxamido)-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| nafcilina | DrugBank |
| nafcillin | ChemIDplus |
| nafcilline | DrugBank |
| nafcillinum | DrugBank |
| Synonyms | Source |
|---|---|
| (2-ethoxy-1-naphthalenyl)penicillin | ChemIDplus |
| (2-ethoxy-1-naphthyl)penicillin | ChemIDplus |
| (2S,5R,6R)-6-[(2-ethoxy-1-naphthoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| (2S,5R,6R)-6-{[(2-ethoxynaphthalen-1-yl)carbonyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| (2S,5R,6R)-6-[(2-ethoxynaphthalene-1-carbonyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| 6-(2-ethoxy-1-naphthamido)penicillanic acid | Patent |
| Citations |
|---|