EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2S2 |
| Net Charge | 0 |
| Average Mass | 206.332 |
| Monoisotopic Mass | 206.04352 |
| SMILES | O=C(O)CCCC[C@H]1CCSS1 |
| InChI | InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10)/t7-/m0/s1 |
| InChIKey | AGBQKNBQESQNJD-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-lipoic acid (CHEBI:43796) has functional parent octanoic acid (CHEBI:28837) |
| (S)-lipoic acid (CHEBI:43796) is a dithiolanes (CHEBI:39192) |
| (S)-lipoic acid (CHEBI:43796) is a heterocyclic fatty acid (CHEBI:48847) |
| (S)-lipoic acid (CHEBI:43796) is a lipoic acid (CHEBI:16494) |
| (S)-lipoic acid (CHEBI:43796) is a thia fatty acid (CHEBI:59643) |
| (S)-lipoic acid (CHEBI:43796) is enantiomer of (R)-lipoic acid (CHEBI:30314) |
| Incoming Relation(s) |
| (R)-lipoic acid (CHEBI:30314) is enantiomer of (S)-lipoic acid (CHEBI:43796) |
| (S)-lipoyl group (CHEBI:38233) is substituent group from (S)-lipoic acid (CHEBI:43796) |
| IUPAC Name |
|---|
| 5-[(3S)-1,2-dithiolan-3-yl]pentanoic acid |
| Synonyms | Source |
|---|---|
| thioctic acid l-form | ChemIDplus |
| (S)-1,2-dithiolane-3-pentanoic acid | ChemIDplus |
| LIPOIC ACID | PDBeChem |
| (S)-(−)-lipoic acid | ChEBI |
| SLA | ChEBI |
| L-6-thioctic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LPA | PDBeChem |
| HMDB0014312 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:81852 | Beilstein |
| CAS:1077-27-6 | ChemIDplus |
| Citations |
|---|