EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5NO2 |
| Net Charge | 0 |
| Average Mass | 147.133 |
| Monoisotopic Mass | 147.03203 |
| SMILES | O=C1Nc2ccccc2C1=O |
| InChI | InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11/h1-4H,(H,9,10,11) |
| InChIKey | JXDYKVIHCLTXOP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isatin (CHEBI:27539) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| isatin (CHEBI:27539) has role plant metabolite (CHEBI:76924) |
| isatin (CHEBI:27539) is a indoledione (CHEBI:24793) |
| Incoming Relation(s) |
| N-acetylisatin (CHEBI:16050) has functional parent isatin (CHEBI:27539) |
| 1-methyl-5-(2-phenoxymethylpyrrolidine-1-sulfonyl)-1H-indole-2,3-dione (CHEBI:44274) has functional parent isatin (CHEBI:27539) |
| 5-(6-aminohexanamido)isatin (CHEBI:59639) has functional parent isatin (CHEBI:27539) |
| 5-aminoisatin (CHEBI:59593) has functional parent isatin (CHEBI:27539) |
| 6-(3'-methylbuten-2-yl)isatin (CHEBI:141376) has functional parent isatin (CHEBI:27539) |
| IUPAC Name |
|---|
| 1H-indole-2,3-dione |
| Synonyms | Source |
|---|---|
| indole-2,3-dione | NIST Chemistry WebBook |
| Isatin | KEGG COMPOUND |
| ISATIN | PDBeChem |
| UniProt Name | Source |
|---|---|
| isatin | UniProt |
| Citations |
|---|