EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO4 |
| Net Charge | 0 |
| Average Mass | 119.076 |
| Monoisotopic Mass | 119.02186 |
| SMILES | NC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C3H5NO4/c4-1(2(5)6)3(7)8/h1H,4H2,(H,5,6)(H,7,8) |
| InChIKey | JINBYESILADKFW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (1621954) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminomalonic acid (CHEBI:17475) has functional parent malonic acid (CHEBI:30794) |
| aminomalonic acid (CHEBI:17475) has role Daphnia magna metabolite (CHEBI:83056) |
| aminomalonic acid (CHEBI:17475) has role human metabolite (CHEBI:77746) |
| aminomalonic acid (CHEBI:17475) is a amino dicarboxylic acid (CHEBI:36164) |
| aminomalonic acid (CHEBI:17475) is conjugate acid of aminomalonate(1−) (CHEBI:58158) |
| Incoming Relation(s) |
| aminomalonate(1−) (CHEBI:58158) is conjugate base of aminomalonic acid (CHEBI:17475) |
| IUPAC Name |
|---|
| aminopropanedioic acid |
| Synonyms | Source |
|---|---|
| Aminomalonate | KEGG COMPOUND |
| Aminomalonic acid | KEGG COMPOUND |
| 2-Aminomalonic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00872 | KEGG COMPOUND |
| C00872 | KEGG COMPOUND |
| FGL | PDBeChem |
| DB02289 | DrugBank |
| HMDB0001147 | HMDB |
| ECMDB21430 | ECMDB |
| AMINOMALONATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1704564 | Reaxys |
| CAS:1068-84-4 | KEGG COMPOUND |
| CAS:1068-84-4 | ChemIDplus |
| Citations |
|---|