EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46N7O18P3S |
| Net Charge | 0 |
| Average Mass | 881.685 |
| Monoisotopic Mass | 881.18329 |
| SMILES | CCC[C@H](O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C27H46N7O18P3S/c1-4-5-15(35)10-18(37)56-9-8-29-17(36)6-7-30-25(40)22(39)27(2,3)12-49-55(46,47)52-54(44,45)48-11-16-21(51-53(41,42)43)20(38)26(50-16)34-14-33-19-23(28)31-13-32-24(19)34/h13-16,20-22,26,35,38-39H,4-12H2,1-3H3,(H,29,36)(H,30,40)(H,44,45)(H,46,47)(H2,28,31,32)(H2,41,42,43)/t15-,16+,20+,21+,22-,26+/m0/s1 |
| InChIKey | VAAHKRMGOFIORX-IKTBLOROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-hydroxyhexanoyl-CoA (CHEBI:28276) has functional parent (S)-3-hydroxyhexanoic acid (CHEBI:37049) |
| (S)-3-hydroxyhexanoyl-CoA (CHEBI:28276) has functional parent coenzyme A (CHEBI:15346) |
| (S)-3-hydroxyhexanoyl-CoA (CHEBI:28276) has role Escherichia coli metabolite (CHEBI:76971) |
| (S)-3-hydroxyhexanoyl-CoA (CHEBI:28276) has role human metabolite (CHEBI:77746) |
| (S)-3-hydroxyhexanoyl-CoA (CHEBI:28276) has role mouse metabolite (CHEBI:75771) |
| (S)-3-hydroxyhexanoyl-CoA (CHEBI:28276) is a hydroxy fatty acyl-CoA (CHEBI:61902) |
| (S)-3-hydroxyhexanoyl-CoA (CHEBI:28276) is conjugate acid of (S)-3-hydroxyhexanoyl-CoA(4−) (CHEBI:62075) |
| Incoming Relation(s) |
| (S)-3-hydroxyhexanoyl-CoA(4−) (CHEBI:62075) is conjugate base of (S)-3-hydroxyhexanoyl-CoA (CHEBI:28276) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-4-({3-[(2-{[(3S)-3-hydroxyhexanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 3-hydroxyhexanoyl-coenzyme A | ChEBI |
| (S)-3-hydroxycaproyl-CoA | ChEBI |
| (S)-3-hydroxycaproyl-coenzyme A | ChEBI |
| (S)-3-Hydroxyhexanoyl-CoA | KEGG COMPOUND |
| (S)-Hydroxyhexanoyl-CoA | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05268 | KEGG COMPOUND |
| LMFA07050017 | LIPID MAPS |