EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:21557 - N-acetyl-L-methionine
| Formula | C7H13NO3S |
| Net Charge | 0 |
| Average Mass | 191.252 |
| Monoisotopic Mass | 191.06161 |
| SMILES | CSCC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 |
| InChIKey | XUYPXLNMDZIRQH-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei brucei (ncbitaxon:5702) | |||
| - | PubMed (23571546) | Strain: WT427 | |
| - | MetaboLights (MTBLS49) | Strain: WT427 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-methionine (CHEBI:21557) has role nutraceutical (CHEBI:50733) |
| N-acetyl-L-methionine (CHEBI:21557) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-methionine (CHEBI:21557) is a N-acetylmethionine (CHEBI:132958) |
| N-acetyl-L-methionine (CHEBI:21557) is a L-methionine derivative (CHEBI:84121) |
| N-acetyl-L-methionine (CHEBI:21557) is conjugate acid of N-acetyl-L-methionine(1−) (CHEBI:71670) |
| N-acetyl-L-methionine (CHEBI:21557) is enantiomer of N-acetyl-D-methionine (CHEBI:85210) |
| Incoming Relation(s) |
| N-acetyl-L-methionine sulfone (CHEBI:88135) has functional parent N-acetyl-L-methionine (CHEBI:21557) |
| N-acetyl-DL-methionine (CHEBI:192695) has part N-acetyl-L-methionine (CHEBI:21557) |
| N-acetyl-L-methionine(1−) (CHEBI:71670) is conjugate base of N-acetyl-L-methionine (CHEBI:21557) |
| N-acetyl-D-methionine (CHEBI:85210) is enantiomer of N-acetyl-L-methionine (CHEBI:21557) |
| N-acetyl-L-methionyl residue (CHEBI:133414) is substituent group from N-acetyl-L-methionine (CHEBI:21557) |
| IUPAC Name |
|---|
| N-acetyl-L-methionine |
| Synonyms | Source |
|---|---|
| N-Acetylmethionine | KEGG COMPOUND |
| Methionamine | ChemIDplus |
| Acetyl-L-methionine | ChemIDplus |
| L-(N-Acetyl)methionine | ChemIDplus |
| Acetylmethionine | NIST Chemistry WebBook |
| AcMet | ChEBI |
| Citations |
|---|