EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N5 |
| Net Charge | 0 |
| Average Mass | 149.157 |
| Monoisotopic Mass | 149.07015 |
| SMILES | Cn1cnc(N)c2ncnc1-2 |
| InChI | InChI=1S/C6H7N5/c1-11-3-10-5(7)4-6(11)9-2-8-4/h2-3H,7H2,1H3 |
| InChIKey | FSASIHFSFGAIJM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyladenine (CHEBI:38635) has role autophagy inhibitor (CHEBI:88230) |
| 3-methyladenine (CHEBI:38635) has role human metabolite (CHEBI:77746) |
| 3-methyladenine (CHEBI:38635) is a methyladenine (CHEBI:25272) |
| IUPAC Names |
|---|
| 3-methyl-3H-purin-6-amine |
| 3-methyladenine |
| Synonyms | Source |
|---|---|
| 3-methyl-3H-adenine | ChemIDplus |
| 3-METHYL-3H-PURIN-6-YLAMINE | PDBeChem |
| 3-Methyladenine | KEGG COMPOUND |
| 6-amino-3-methylpurine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 3-Methyl-Adenines | MetaCyc |
| ADK | PDBeChem |
| C00913 | KEGG COMPOUND |
| DB04104 | DrugBank |
| HMDB0011600 | HMDB |
| LSM-4733 | LINCS |
| Citations |
|---|