EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H58N7O18P3S |
| Net Charge | 0 |
| Average Mass | 965.847 |
| Monoisotopic Mass | 965.27719 |
| SMILES | CCCCCCCCC[C@H](O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C33H58N7O18P3S/c1-4-5-6-7-8-9-10-11-21(41)16-24(43)62-15-14-35-23(42)12-13-36-31(46)28(45)33(2,3)18-55-61(52,53)58-60(50,51)54-17-22-27(57-59(47,48)49)26(44)32(56-22)40-20-39-25-29(34)37-19-38-30(25)40/h19-22,26-28,32,41,44-45H,4-18H2,1-3H3,(H,35,42)(H,36,46)(H,50,51)(H,52,53)(H2,34,37,38)(H2,47,48,49)/t21-,22+,26+,27+,28-,32+/m0/s1 |
| InChIKey | IJFLXRCJWPKGKJ-LXIXEQKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) has functional parent (S)-3-hydroxylauric acid (CHEBI:36210) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) has functional parent lauroyl-CoA (CHEBI:15521) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) has role Escherichia coli metabolite (CHEBI:76971) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) has role human metabolite (CHEBI:77746) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) has role mouse metabolite (CHEBI:75771) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) is a (S)-3-hydroxyacyl-CoA (CHEBI:15455) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) is a 3-hydroxy fatty acyl-CoA (CHEBI:20060) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) is a medium-chain fatty acyl-CoA (CHEBI:61907) |
| (S)-3-hydroxylauroyl-CoA (CHEBI:27668) is conjugate acid of (S)-3-hydroxylauroyl-CoA(4−) (CHEBI:62558) |
| Incoming Relation(s) |
| (S)-3-hydroxylauroyl-CoA(4−) (CHEBI:62558) is conjugate base of (S)-3-hydroxylauroyl-CoA (CHEBI:27668) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-4-({3-[(2-{[(3S)-3-hydroxydodecanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| (S)-3-hydroxydodecanoyl-coenzyme A | ChEBI |
| (S)-3-hydroxylauroyl-coenzyme A | ChEBI |
| (S)-3-Hydroxydodecanoyl-CoA | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05262 | KEGG COMPOUND |
| HMDB0003936 | HMDB |
| LMFA07050012 | LIPID MAPS |