EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O6 |
| Net Charge | 0 |
| Average Mass | 226.184 |
| Monoisotopic Mass | 226.04774 |
| SMILES | C=C(O[C@@H]1C=C(C(=O)O)C=C[C@H]1O)C(=O)O |
| InChI | InChI=1S/C10H10O6/c1-5(9(12)13)16-8-4-6(10(14)15)2-3-7(8)11/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/t7-,8-/m1/s1 |
| InChIKey | WTFXTQVDAKGDEY-HTQZYQBOSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (11745165) | ||
| - | PubMed (21988831) | ||
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (8971708) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chorismic acid (CHEBI:17333) has role Escherichia coli metabolite (CHEBI:76971) |
| chorismic acid (CHEBI:17333) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| chorismic acid (CHEBI:17333) has role plant metabolite (CHEBI:76924) |
| chorismic acid (CHEBI:17333) is a 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid (CHEBI:36166) |
| chorismic acid (CHEBI:17333) is conjugate acid of chorismate(2−) (CHEBI:29748) |
| Incoming Relation(s) |
| 4-amino-4-deoxychorismic acid (CHEBI:18198) has functional parent chorismic acid (CHEBI:17333) |
| chorismate(2−) (CHEBI:29748) is conjugate base of chorismic acid (CHEBI:17333) |
| IUPAC Name |
|---|
| (3R,4R)-3-[(1-carboxyethenyl)oxy]-4-hydroxycyclohexa-1,5-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| (3R,4R)-3-[(1-carboxyvinyl)oxy]-4-hydroxycyclohexa-1,5-diene-1-carboxylic acid | IUPAC |
| (3R-trans)-3-((1-carboxyethenyl)oxy)-4-hydroxy-1,5-cyclohexadiene-1-carboxylic acid | ChemIDplus |
| Chorismic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000733 | KNApSAcK |
| C00251 | KEGG COMPOUND |
| Chorismic_acid | Wikipedia |
| ECMDB12199 | ECMDB |
| HMDB0012199 | HMDB |
| YMDB00148 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2217365 | Reaxys |
| Beilstein:5038108 | Beilstein |
| CAS:617-12-9 | ChemIDplus |
| CAS:617-12-9 | KEGG COMPOUND |
| Citations |
|---|