EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O4 |
| Net Charge | 0 |
| Average Mass | 378.553 |
| Monoisotopic Mass | 378.27701 |
| SMILES | [H]C(CO)(CO)OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C23H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)27-22(20-24)21-25/h6-7,9-10,12-13,15-16,22,24-25H,2-5,8,11,14,17-21H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | RCRCTBLIHCHWDZ-DOFZRALJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (12878451) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-arachidonoylglycerol (CHEBI:52392) has functional parent arachidonic acid (CHEBI:15843) |
| 2-arachidonoylglycerol (CHEBI:52392) has role human metabolite (CHEBI:77746) |
| 2-arachidonoylglycerol (CHEBI:52392) is a 2-acylglycerol 20:4 (CHEBI:134144) |
| 2-arachidonoylglycerol (CHEBI:52392) is a endocannabinoid (CHEBI:67197) |
| Incoming Relation(s) |
| 12-HPETE 2-glyceryl ester (CHEBI:146254) has functional parent 2-arachidonoylglycerol (CHEBI:52392) |
| IUPAC Name |
|---|
| 1,3-dihydroxypropan-2-yl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| Synonyms | Source |
|---|---|
| 2-AG | SUBMITTER |
| 2-AG | KEGG COMPOUND |
| 2-Arachidonoyl-glycerol | ChemIDplus |
| 2-Arachidonoylglycerol | KEGG COMPOUND |
| 2-Arachidonyl-glycerol | ChemIDplus |
| 2-Ara-Gl | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2-Arachidonoylglycerol | Wikipedia |
| C13856 | KEGG COMPOUND |
| CPD-12600 | MetaCyc |
| HMDB0004666 | HMDB |
| LMGL01010023 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8167264 | Reaxys |
| CAS:53847-30-6 | ChemIDplus |
| CAS:53847-30-6 | KEGG COMPOUND |
| Citations |
|---|