EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6Cl2O |
| Net Charge | 0 |
| Average Mass | 128.986 |
| Monoisotopic Mass | 127.97957 |
| SMILES | OC(CCl)CCl |
| InChI | InChI=1S/C3H6Cl2O/c4-1-3(6)2-5/h3,6H,1-2H2 |
| InChIKey | DEWLEGDTCGBNGU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| Applications: | cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-dichloropropan-2-ol (CHEBI:18917) has role cross-linking reagent (CHEBI:50684) |
| 1,3-dichloropropan-2-ol (CHEBI:18917) has role protic solvent (CHEBI:48356) |
| 1,3-dichloropropan-2-ol (CHEBI:18917) is a organochlorine compound (CHEBI:36683) |
| 1,3-dichloropropan-2-ol (CHEBI:18917) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 1,3-dichloroacetone (CHEBI:156485) has functional parent 1,3-dichloropropan-2-ol (CHEBI:18917) |
| IUPAC Name |
|---|
| 1,3-dichloropropan-2-ol |
| Synonyms | Source |
|---|---|
| 1,3-Dichloro-2-propanol | KEGG COMPOUND |
| sym-dichloroisopropyl alcohol | ChemIDplus |
| 1,3-dichloro-2-hydroxypropane | ChemIDplus |
| 1,3-dichlorohydrin | ChemIDplus |
| 1,3-dichloroisopropyl alcohol | ChemIDplus |
| 1,3-dichloroisopropanol | ChemIDplus |
| Citations |
|---|