EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O3 |
| Net Charge | 0 |
| Average Mass | 188.227 |
| Monoisotopic Mass | 188.11609 |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C8H16N2O3/c1-6(11)10-7(8(12)13)4-2-3-5-9/h7H,2-5,9H2,1H3,(H,10,11)(H,12,13)/t7-/m0/s1 |
| InChIKey | VEYYWZRYIYDQJM-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (16274666) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS88) | ||
| - | DOI (10.1371/journal.pone.0115359) | ||
| - | MetaboLights (MTBLS87) | ||
| - | MetaboLights (MTBLS125) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-acetyl-L-lysine (CHEBI:35704) has role human metabolite (CHEBI:77746) |
| N2-acetyl-L-lysine (CHEBI:35704) is a acetyl-L-lysine (CHEBI:22193) |
| N2-acetyl-L-lysine (CHEBI:35704) is tautomer of N2-acetyl-L-lysine zwitterion (CHEBI:61512) |
| Incoming Relation(s) |
| N2-acetyl-L-lysine zwitterion (CHEBI:61512) is tautomer of N2-acetyl-L-lysine (CHEBI:35704) |
| IUPAC Name |
|---|
| N2-acetyl-L-lysine |
| Synonyms | Source |
|---|---|
| N2-Acetyl-L-lysine | KEGG COMPOUND |
| Nα-acetyl-L-lysine | JCBN |
| (2S)-2-(acetylamino)-6-aminohexanoic acid | IUPAC |
| N-α-acetyl-L-lysine | ChemIDplus |
| N(α)-acetyllysine | ChemIDplus |
| N-acetyl-L-lysine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C12989 | KEGG COMPOUND |
| HMDB0000446 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1726281 | Beilstein |
| Gmelin:747423 | Gmelin |
| Reaxys:1726281 | Reaxys |
| CAS:1946-82-3 | ChemIDplus |
| Citations |
|---|